C19H25N5O3 — CID 55922079
1-[(3,5-dimethoxyphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea (PubChem CID 55922079) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55922079 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
| SMILES | COc1cc(CNC(=O)NC2CCN(c3ncccn3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-26-16-10-14(11-17(12-16)27-2)13-22-19(25)23-15-4-8-24(9-5-15)18-20-6-3-7-21-18/h3,6-7,10-12,15H,4-5,8-9,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | FCLKWYSUQUPAMY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |