C17H23F2N3OS — CID 2363194
1-cyclohexyl-3-[[(Z)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]amino]thiourea (PubChem CID 2363194) has the molecular formula C17H23F2N3OS and a molecular weight of 355.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[(Z)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[(Z)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]amino]thiourea |
|---|---|
| PubChem CID | 2363194 |
| Molecular Formula | C17H23F2N3OS |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-cyclohexyl-3-[[(Z)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]amino]thiourea |
| SMILES | C/C=C(\NNC(=S)NC1CCCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H23F2N3OS/c1-2-15(12-8-10-14(11-9-12)23-16(18)19)21-22-17(24)20-13-6-4-3-5-7-13/h2,8-11,13,16,21H,3-7H2,1H3,(H2,20,22,24)/b15-2- |
| InChIKey | LOLCWGBWNRYUBV-LXOGZNDWSA-N |
| XLogP | 3.95 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|