C18H23F2NO2 — CID 7962251
(E)-N-cyclooctyl-3-[4-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 7962251) has the molecular formula C18H23F2NO2 and a molecular weight of 323.38 g/mol. Its IUPAC name is (E)-N-cyclooctyl-3-[4-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclooctyl-3-[4-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7962251 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (E)-N-cyclooctyl-3-[4-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C18H23F2NO2/c19-18(20)23-16-11-8-14(9-12-16)10-13-17(22)21-15-6-4-2-1-3-5-7-15/h8-13,15,18H,1-7H2,(H,21,22)/b13-10+ |
| InChIKey | KZVFUPNDHPCPHV-JLHYYAGUSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|