C15H22F2N3OS+ — CID 8678796
1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8678796) has the molecular formula C15H22F2N3OS+ and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8678796 |
| Molecular Formula | C15H22F2N3OS+ |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | C[C@H](NC(=S)NCC[NH+]1CCOCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H21F2N3OS/c1-11(12-2-3-13(16)14(17)10-12)19-15(22)18-4-5-20-6-8-21-9-7-20/h2-3,10-11H,4-9H2,1H3,(H2,18,19,22)/p+1/t11-/m0/s1 |
| InChIKey | JKZARXIHIFFZLQ-NSHDSACASA-O |
| XLogP | 0.41 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|