C15H23ClN3OS+ — CID 8676518
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8676518) has the molecular formula C15H23ClN3OS+ and a molecular weight of 328.89 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8676518 |
| Molecular Formula | C15H23ClN3OS+ |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | C[C@H](NC(=S)NCC[NH+]1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-12(13-2-4-14(16)5-3-13)18-15(21)17-6-7-19-8-10-20-11-9-19/h2-5,12H,6-11H2,1H3,(H2,17,18,21)/p+1/t12-/m0/s1 |
| InChIKey | FEJVNWJOEQWGIK-LBPRGKRZSA-O |
| XLogP | 0.78 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|