C20H25ClN3OS+ — CID 8563448
1-(4-chlorophenyl)-3-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea (PubChem CID 8563448) has the molecular formula C20H25ClN3OS+ and a molecular weight of 390.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 8563448 |
| Molecular Formula | C20H25ClN3OS+ |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
| SMILES | Cc1ccc([C@@H](C[NH+]2CCOCC2)NC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H24ClN3OS/c1-15-2-4-16(5-3-15)19(14-24-10-12-25-13-11-24)23-20(26)22-18-8-6-17(21)7-9-18/h2-9,19H,10-14H2,1H3,(H2,22,23,26)/p+1/t19-/m1/s1 |
| InChIKey | IQDKYLDSLKZYCG-LJQANCHMSA-O |
| XLogP | 2.59 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|