C18H22ClN2O2S+ — CID 9144528
5-chloro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiophene-2-carboxamide (PubChem CID 9144528) has the molecular formula C18H22ClN2O2S+ and a molecular weight of 365.91 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9144528 |
| Molecular Formula | C18H22ClN2O2S+ |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 5-chloro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc([C@H](C[NH+]2CCOCC2)NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-13-2-4-14(5-3-13)15(12-21-8-10-23-11-9-21)20-18(22)16-6-7-17(19)24-16/h2-7,15H,8-12H2,1H3,(H,20,22)/p+1/t15-/m0/s1 |
| InChIKey | QXEYCRVXPMXMEE-HNNXBMFYSA-O |
| XLogP | 2.10 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |