C23H27N2O4+ — CID 9144488
(E)-3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide (PubChem CID 9144488) has the molecular formula C23H27N2O4+ and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9144488 |
| Molecular Formula | C23H27N2O4+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@@H](C[NH+]2CCOCC2)NC(=O)/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-17-2-6-19(7-3-17)20(15-25-10-12-27-13-11-25)24-23(26)9-5-18-4-8-21-22(14-18)29-16-28-21/h2-9,14,20H,10-13,15-16H2,1H3,(H,24,26)/p+1/b9-5+/t20-/m1/s1 |
| InChIKey | POBTYHYTEKSKSN-MVHVFESUSA-O |
| XLogP | 1.51 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|