C14H13NO3 — CID 114389707
(E)-3-(1,3-benzodioxol-5-yl)-N-but-3-yn-2-ylprop-2-enamide (PubChem CID 114389707) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-but-3-yn-2-ylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-but-3-yn-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 114389707 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-but-3-yn-2-ylprop-2-enamide |
| SMILES | C#CC(C)NC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13NO3/c1-3-10(2)15-14(16)7-5-11-4-6-12-13(8-11)18-9-17-12/h1,4-8,10H,9H2,2H3,(H,15,16)/b7-5+ |
| InChIKey | JYYFMPBCOAOLDP-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|