C22H26ClN2O2+ — CID 9149716
(E)-3-(3-chloro-4-methylphenyl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide (PubChem CID 9149716) has the molecular formula C22H26ClN2O2+ and a molecular weight of 385.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9149716 |
| Molecular Formula | C22H26ClN2O2+ |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H25ClN2O2/c1-17-7-8-18(15-20(17)23)9-10-22(26)24-21(19-5-3-2-4-6-19)16-25-11-13-27-14-12-25/h2-10,15,21H,11-14,16H2,1H3,(H,24,26)/p+1/b10-9+/t21-/m0/s1 |
| InChIKey | FJMWAEQIOJNVDR-GLCJEOIMSA-O |
| XLogP | 2.43 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|