C22H28N3O3S+ — CID 8563597
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea (PubChem CID 8563597) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 8563597 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
| SMILES | Cc1ccc([C@H](C[NH+]2CCOCC2)NC(=S)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-16-2-5-18(6-3-16)19(14-25-8-10-26-11-9-25)24-22(29)23-13-17-4-7-20-21(12-17)28-15-27-20/h2-7,12,19H,8-11,13-15H2,1H3,(H2,23,24,29)/p+1/t19-/m0/s1 |
| InChIKey | ATCGUQSEYLSQQY-IBGZPJMESA-O |
| XLogP | 1.34 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|