C15H13FN2O3 — CID 71863070
3-N-(5-fluoro-2-hydroxyphenyl)-1-N-methylbenzene-1,3-dicarboxamide (PubChem CID 71863070) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 3-N-(5-fluoro-2-hydroxyphenyl)-1-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(5-fluoro-2-hydroxyphenyl)-1-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71863070 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-N-(5-fluoro-2-hydroxyphenyl)-1-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CNC(=O)c1cccc(C(=O)Nc2cc(F)ccc2O)c1 |
| InChI | InChI=1S/C15H13FN2O3/c1-17-14(20)9-3-2-4-10(7-9)15(21)18-12-8-11(16)5-6-13(12)19/h2-8,19H,1H3,(H,17,20)(H,18,21) |
| InChIKey | UUXXRRRIBPMBJT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|