C10H8F4N2O — CID 162607713
N-(3-amino-2,4-difluorophenyl)-2,2-difluorobut-3-enamide (PubChem CID 162607713) has the molecular formula C10H8F4N2O and a molecular weight of 248.18 g/mol. Its IUPAC name is N-(3-amino-2,4-difluorophenyl)-2,2-difluorobut-3-enamide.
| Compound Name | N-(3-amino-2,4-difluorophenyl)-2,2-difluorobut-3-enamide |
|---|---|
| PubChem CID | 162607713 |
| Molecular Formula | C10H8F4N2O |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-(3-amino-2,4-difluorophenyl)-2,2-difluorobut-3-enamide |
| SMILES | C=CC(F)(F)C(=O)Nc1ccc(F)c(N)c1F |
| InChI | InChI=1S/C10H8F4N2O/c1-2-10(13,14)9(17)16-6-4-3-5(11)8(15)7(6)12/h2-4H,1,15H2,(H,16,17) |
| InChIKey | PGPFRPLSFFOLOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|