C21H23F3N2O2 — CID 108968690
N-(4-tert-butylphenyl)-2,2-dimethyl-N'-(2,3,4-trifluorophenyl)propanediamide (PubChem CID 108968690) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2,2-dimethyl-N'-(2,3,4-trifluorophenyl)propanediamide.
| Compound Name | N-(4-tert-butylphenyl)-2,2-dimethyl-N'-(2,3,4-trifluorophenyl)propanediamide |
|---|---|
| PubChem CID | 108968690 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-(4-tert-butylphenyl)-2,2-dimethyl-N'-(2,3,4-trifluorophenyl)propanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H23F3N2O2/c1-20(2,3)12-6-8-13(9-7-12)25-18(27)21(4,5)19(28)26-15-11-10-14(22)16(23)17(15)24/h6-11H,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | GTCOMOBUSNKGOD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|