C10H10Cl2N2OS — CID 19906335
O-prop-2-enyl N-(2,4-dichloroanilino)carbamothioate (PubChem CID 19906335) has the molecular formula C10H10Cl2N2OS and a molecular weight of 277.18 g/mol. Its IUPAC name is O-prop-2-enyl N-(2,4-dichloroanilino)carbamothioate.
| Compound Name | O-prop-2-enyl N-(2,4-dichloroanilino)carbamothioate |
|---|---|
| PubChem CID | 19906335 |
| Molecular Formula | C10H10Cl2N2OS |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | O-prop-2-enyl N-(2,4-dichloroanilino)carbamothioate |
| SMILES | C=CCOC(=S)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2OS/c1-2-5-15-10(16)14-13-9-4-3-7(11)6-8(9)12/h2-4,6,13H,1,5H2,(H,14,16) |
| InChIKey | KOUNVYXROLJRLO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|