C9H8Cl2N2O — CID 108909057
1-(2,4-dichlorophenyl)-3-ethenylurea (PubChem CID 108909057) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-ethenylurea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-ethenylurea |
|---|---|
| PubChem CID | 108909057 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-ethenylurea |
| SMILES | C=CNC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O/c1-2-12-9(14)13-8-4-3-6(10)5-7(8)11/h2-5H,1H2,(H2,12,13,14) |
| InChIKey | ULQUQWLTTVZJTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |