About 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea
1-cyclopropyl-3-(2,4-dichloroanilino)thiourea (PubChem CID 8769459) has the molecular formula C10H11Cl2N3S
and a molecular weight of 276.19 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea |
| PubChem CID | 8769459 |
| Molecular Formula | C10H11Cl2N3S |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea |
| SMILES | S=C(NNc1ccc(Cl)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C10H11Cl2N3S/c11-6-1-4-9(8(12)5-6)14-15-10(16)13-7-2-3-7/h1,4-5,7,14H,2-3H2,(H2,13,15,16) |
| InChIKey | JRGLEKHLZWIDPP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea?
The IUPAC name of 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea (CID 8769459) is 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea.
What is the SMILES notation for 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea?
The canonical SMILES for 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea is S=C(NNc1ccc(Cl)cc1Cl)NC1CC1.
What is the InChIKey of 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea?
The InChIKey is JRGLEKHLZWIDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2N3S/c11-6-1-4-9(8(12)5-6)14-15-10(16)13-7-2-3-7/h1,4-5,7,14H,2-3H2,(H2,13,15,16).
What are the key properties of 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea?
1-cyclopropyl-3-(2,4-dichloroanilino)thiourea has a molecular weight of 276.19 g/mol, XLogP of 2.95, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(2,4-dichloroanilino)thiourea is sourced from PubChem (CID 8769459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).