C18H15Cl3N2O5 — CID 54127398
methyl 2-[4-chloro-2-[(2,4-dichloroanilino)carbamoyl]phenoxy]-3-methoxyprop-2-enoate (PubChem CID 54127398) has the molecular formula C18H15Cl3N2O5 and a molecular weight of 445.69 g/mol. Its IUPAC name is methyl 2-[4-chloro-2-[(2,4-dichloroanilino)carbamoyl]phenoxy]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[4-chloro-2-[(2,4-dichloroanilino)carbamoyl]phenoxy]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54127398 |
| Molecular Formula | C18H15Cl3N2O5 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | methyl 2-[4-chloro-2-[(2,4-dichloroanilino)carbamoyl]phenoxy]-3-methoxyprop-2-enoate |
| SMILES | COC=C(Oc1ccc(Cl)cc1C(=O)NNc1ccc(Cl)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C18H15Cl3N2O5/c1-26-9-16(18(25)27-2)28-15-6-4-10(19)7-12(15)17(24)23-22-14-5-3-11(20)8-13(14)21/h3-9,22H,1-2H3,(H,23,24) |
| InChIKey | NRYCKGCDYHZTRP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|