C13H13BrO6 — CID 70193231
methyl 5-bromo-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate (PubChem CID 70193231) has the molecular formula C13H13BrO6 and a molecular weight of 345.15 g/mol. Its IUPAC name is methyl 5-bromo-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate.
| Compound Name | methyl 5-bromo-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 70193231 |
| Molecular Formula | C13H13BrO6 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | methyl 5-bromo-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
| SMILES | CO/C=C(/Oc1ccc(Br)cc1C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H13BrO6/c1-17-7-11(13(16)19-3)20-10-5-4-8(14)6-9(10)12(15)18-2/h4-7H,1-3H3/b11-7+ |
| InChIKey | ASDFQFQDOKYVHC-YRNVUSSQSA-N |
| XLogP | 2.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|