methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate

C15H10BrFO4 — CID 17339880

IUPACmethyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate
SMILESCOC(=O)c1cc(Br)ccc1OC(=O)c1ccc(F)cc1
InChIInChI=1S/C15H10BrFO4/c1-20-15(19)12-8-10(16)4-7-13(12)21-14(18)9-2-5-11(17)6-3-9/h2-8H,1H3
InChIKeyWETIQXPPJNWYHG-UHFFFAOYSA-N
MW353.14 g/mol
LogP3.59
Rot. Bonds3

About methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate

methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate (PubChem CID 17339880) has the molecular formula C15H10BrFO4 and a molecular weight of 353.14 g/mol. Its IUPAC name is methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate.

Molecular Properties

Compound Namemethyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate
PubChem CID17339880
Molecular FormulaC15H10BrFO4
Molecular Weight353.14 g/mol
Exact Mass351.97
IUPAC Namemethyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate
SMILESCOC(=O)c1cc(Br)ccc1OC(=O)c1ccc(F)cc1
InChIInChI=1S/C15H10BrFO4/c1-20-15(19)12-8-10(16)4-7-13(12)21-14(18)9-2-5-11(17)6-3-9/h2-8H,1H3
InChIKeyWETIQXPPJNWYHG-UHFFFAOYSA-N
XLogP3.59
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.14
LogP ≤ 53.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate?
The IUPAC name of methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate (CID 17339880) is methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate.
What is the SMILES notation for methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate?
The canonical SMILES for methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate is COC(=O)c1cc(Br)ccc1OC(=O)c1ccc(F)cc1.
What is the InChIKey of methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate?
The InChIKey is WETIQXPPJNWYHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrFO4/c1-20-15(19)12-8-10(16)4-7-13(12)21-14(18)9-2-5-11(17)6-3-9/h2-8H,1H3.
What are the key properties of methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate?
methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate has a molecular weight of 353.14 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-2-(4-fluorobenzoyl)oxybenzoate is sourced from PubChem (CID 17339880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).