C15H8BrF3O4 — CID 176652645
methyl 2-bromo-4,5-difluoro-3-(4-fluorobenzoyl)oxybenzoate (PubChem CID 176652645) has the molecular formula C15H8BrF3O4 and a molecular weight of 389.12 g/mol. Its IUPAC name is methyl 2-bromo-4,5-difluoro-3-(4-fluorobenzoyl)oxybenzoate.
| Compound Name | methyl 2-bromo-4,5-difluoro-3-(4-fluorobenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 176652645 |
| Molecular Formula | C15H8BrF3O4 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | methyl 2-bromo-4,5-difluoro-3-(4-fluorobenzoyl)oxybenzoate |
| SMILES | COC(=O)c1cc(F)c(F)c(OC(=O)c2ccc(F)cc2)c1Br |
| InChI | InChI=1S/C15H8BrF3O4/c1-22-15(21)9-6-10(18)12(19)13(11(9)16)23-14(20)7-2-4-8(17)5-3-7/h2-6H,1H3 |
| InChIKey | GZAGNEWOHKWVCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|