About (2-bromo-4-fluorophenyl) 4-methoxybenzoate
(2-bromo-4-fluorophenyl) 4-methoxybenzoate (PubChem CID 530779) has the molecular formula C14H10BrFO3
and a molecular weight of 325.13 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl) 4-methoxybenzoate.
Molecular Properties
| Compound Name | (2-bromo-4-fluorophenyl) 4-methoxybenzoate |
| PubChem CID | 530779 |
| Molecular Formula | C14H10BrFO3 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | (2-bromo-4-fluorophenyl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C14H10BrFO3/c1-18-11-5-2-9(3-6-11)14(17)19-13-7-4-10(16)8-12(13)15/h2-8H,1H3 |
| InChIKey | VHYFITGEFVNZRZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-fluorophenyl) 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-fluorophenyl) 4-methoxybenzoate?
The IUPAC name of (2-bromo-4-fluorophenyl) 4-methoxybenzoate (CID 530779) is (2-bromo-4-fluorophenyl) 4-methoxybenzoate.
What is the SMILES notation for (2-bromo-4-fluorophenyl) 4-methoxybenzoate?
The canonical SMILES for (2-bromo-4-fluorophenyl) 4-methoxybenzoate is COc1ccc(C(=O)Oc2ccc(F)cc2Br)cc1.
What is the InChIKey of (2-bromo-4-fluorophenyl) 4-methoxybenzoate?
The InChIKey is VHYFITGEFVNZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrFO3/c1-18-11-5-2-9(3-6-11)14(17)19-13-7-4-10(16)8-12(13)15/h2-8H,1H3.
What are the key properties of (2-bromo-4-fluorophenyl) 4-methoxybenzoate?
(2-bromo-4-fluorophenyl) 4-methoxybenzoate has a molecular weight of 325.13 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-fluorophenyl) 4-methoxybenzoate is sourced from PubChem (CID 530779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).