C20H17ClO7 — CID 70194027
phenacyl 5-chloro-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate (PubChem CID 70194027) has the molecular formula C20H17ClO7 and a molecular weight of 404.80 g/mol. Its IUPAC name is phenacyl 5-chloro-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate.
| Compound Name | phenacyl 5-chloro-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 70194027 |
| Molecular Formula | C20H17ClO7 |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | phenacyl 5-chloro-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]oxybenzoate |
| SMILES | CO/C=C(/Oc1ccc(Cl)cc1C(=O)OCC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C20H17ClO7/c1-25-12-18(20(24)26-2)28-17-9-8-14(21)10-15(17)19(23)27-11-16(22)13-6-4-3-5-7-13/h3-10,12H,11H2,1-2H3/b18-12+ |
| InChIKey | HQGHOCLLCSQRGY-LDADJPATSA-N |
| XLogP | 3.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|