C23H18ClNO6 — CID 70193189
2-[4-chloro-2-[(3-phenoxyphenyl)carbamoyl]phenoxy]-3-methoxyprop-2-enoic acid (PubChem CID 70193189) has the molecular formula C23H18ClNO6 and a molecular weight of 439.85 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3-phenoxyphenyl)carbamoyl]phenoxy]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[4-chloro-2-[(3-phenoxyphenyl)carbamoyl]phenoxy]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 70193189 |
| Molecular Formula | C23H18ClNO6 |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[4-chloro-2-[(3-phenoxyphenyl)carbamoyl]phenoxy]-3-methoxyprop-2-enoic acid |
| SMILES | COC=C(Oc1ccc(Cl)cc1C(=O)Nc1cccc(Oc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C23H18ClNO6/c1-29-14-21(23(27)28)31-20-11-10-15(24)12-19(20)22(26)25-16-6-5-9-18(13-16)30-17-7-3-2-4-8-17/h2-14H,1H3,(H,25,26)(H,27,28) |
| InChIKey | NYZXATZLRQAAPT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|