C10H9Cl2NO2 — CID 134105159
methyl (Z)-3-(2,4-dichloroanilino)prop-2-enoate (PubChem CID 134105159) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is methyl (Z)-3-(2,4-dichloroanilino)prop-2-enoate.
| Compound Name | methyl (Z)-3-(2,4-dichloroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 134105159 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | methyl (Z)-3-(2,4-dichloroanilino)prop-2-enoate |
| SMILES | COC(=O)/C=C\Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO2/c1-15-10(14)4-5-13-9-3-2-7(11)6-8(9)12/h2-6,13H,1H3/b5-4- |
| InChIKey | XVSICXZVFITWQH-PLNGDYQASA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|