C17H15Cl2NO — CID 18528061
(Z)-3-(2,4-dichloroanilino)-1-(4-ethylphenyl)prop-2-en-1-one (PubChem CID 18528061) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is (Z)-3-(2,4-dichloroanilino)-1-(4-ethylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-(2,4-dichloroanilino)-1-(4-ethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18528061 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (Z)-3-(2,4-dichloroanilino)-1-(4-ethylphenyl)prop-2-en-1-one |
| SMILES | CCc1ccc(C(=O)/C=C\Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO/c1-2-12-3-5-13(6-4-12)17(21)9-10-20-16-8-7-14(18)11-15(16)19/h3-11,20H,2H2,1H3/b10-9- |
| InChIKey | BEIGEJAIBJTLFJ-KTKRTIGZSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|