C10H13Cl2NO2P+ — CID 70152317
4-(2,4-dichloroanilino)butyl-hydroxy-oxophosphanium (PubChem CID 70152317) has the molecular formula C10H13Cl2NO2P+ and a molecular weight of 281.10 g/mol. Its IUPAC name is 4-(2,4-dichloroanilino)butyl-hydroxy-oxophosphanium.
| Compound Name | 4-(2,4-dichloroanilino)butyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70152317 |
| Molecular Formula | C10H13Cl2NO2P+ |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 4-(2,4-dichloroanilino)butyl-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)CCCCNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2NO2P/c11-8-3-4-10(9(12)7-8)13-5-1-2-6-16(14)15/h3-4,7,13H,1-2,5-6H2/p+1 |
| InChIKey | ZEOMBMPPCULFTM-UHFFFAOYSA-O |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|