C16H21NO3 — CID 43121263
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,5-dimethoxyaniline (PubChem CID 43121263) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,5-dimethoxyaniline.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 43121263 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NC(C)c2cc(C)oc2C)c1 |
| InChI | InChI=1S/C16H21NO3/c1-10-8-14(12(3)20-10)11(2)17-15-9-13(18-4)6-7-16(15)19-5/h6-9,11,17H,1-5H3 |
| InChIKey | VNXXXXYQIGJVDZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |