C18H19NO3 — CID 43824329
N-[1-(1-benzofuran-2-yl)ethyl]-2,5-dimethoxyaniline (PubChem CID 43824329) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2,5-dimethoxyaniline.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 43824329 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,5-dimethoxyaniline |
| SMILES | COc1ccc(OC)c(NC(C)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C18H19NO3/c1-12(18-10-13-6-4-5-7-16(13)22-18)19-15-11-14(20-2)8-9-17(15)21-3/h4-12,19H,1-3H3 |
| InChIKey | LENDEBCVMJCVOZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |