C11H6BrClF2O — CID 106855486
2-bromo-3-[chloro-(2,4-difluorophenyl)methyl]furan (PubChem CID 106855486) has the molecular formula C11H6BrClF2O and a molecular weight of 307.52 g/mol. Its IUPAC name is 2-bromo-3-[chloro-(2,4-difluorophenyl)methyl]furan.
| Compound Name | 2-bromo-3-[chloro-(2,4-difluorophenyl)methyl]furan |
|---|---|
| PubChem CID | 106855486 |
| Molecular Formula | C11H6BrClF2O |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 2-bromo-3-[chloro-(2,4-difluorophenyl)methyl]furan |
| SMILES | Fc1ccc(C(Cl)c2ccoc2Br)c(F)c1 |
| InChI | InChI=1S/C11H6BrClF2O/c12-11-8(3-4-16-11)10(13)7-2-1-6(14)5-9(7)15/h1-5,10H |
| InChIKey | FZAQFGKJHGOCTI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|