C13H13BrFNO — CID 106857490
1-(2-bromofuran-3-yl)-1-(4-fluoro-2-methylphenyl)-N-methylmethanamine (PubChem CID 106857490) has the molecular formula C13H13BrFNO and a molecular weight of 298.16 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-1-(4-fluoro-2-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-1-(4-fluoro-2-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106857490 |
| Molecular Formula | C13H13BrFNO |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-1-(4-fluoro-2-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(F)cc1C)c1ccoc1Br |
| InChI | InChI=1S/C13H13BrFNO/c1-8-7-9(15)3-4-10(8)12(16-2)11-5-6-17-13(11)14/h3-7,12,16H,1-2H3 |
| InChIKey | AGSUJYQYYNIPKP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |