C12H10Br2FNO — CID 106858995
1-(3-bromo-2-fluorophenyl)-1-(2-bromofuran-3-yl)-N-methylmethanamine (PubChem CID 106858995) has the molecular formula C12H10Br2FNO and a molecular weight of 363.02 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-1-(2-bromofuran-3-yl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-1-(2-bromofuran-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106858995 |
| Molecular Formula | C12H10Br2FNO |
| Molecular Weight | 363.02 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-1-(2-bromofuran-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccoc1Br)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H10Br2FNO/c1-16-11(8-5-6-17-12(8)14)7-3-2-4-9(13)10(7)15/h2-6,11,16H,1H3 |
| InChIKey | JVCGBTASBFPESW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |