C18H16BrNO — CID 106851546
1-(2-bromofuran-3-yl)-N-methyl-1-(4-phenylphenyl)methanamine (PubChem CID 106851546) has the molecular formula C18H16BrNO and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-N-methyl-1-(4-phenylphenyl)methanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-N-methyl-1-(4-phenylphenyl)methanamine |
|---|---|
| PubChem CID | 106851546 |
| Molecular Formula | C18H16BrNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-N-methyl-1-(4-phenylphenyl)methanamine |
| SMILES | CNC(c1ccc(-c2ccccc2)cc1)c1ccoc1Br |
| InChI | InChI=1S/C18H16BrNO/c1-20-17(16-11-12-21-18(16)19)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-12,17,20H,1H3 |
| InChIKey | UOPSYBDGNDCLKA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |