C13H10BrF4NO — CID 107291665
1-(2-bromofuran-3-yl)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine (PubChem CID 107291665) has the molecular formula C13H10BrF4NO and a molecular weight of 352.13 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107291665 |
| Molecular Formula | C13H10BrF4NO |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylmethanamine |
| SMILES | CNC(c1ccc(C(F)(F)F)c(F)c1)c1ccoc1Br |
| InChI | InChI=1S/C13H10BrF4NO/c1-19-11(8-4-5-20-12(8)14)7-2-3-9(10(15)6-7)13(16,17)18/h2-6,11,19H,1H3 |
| InChIKey | ZABSWPHTIUGEMH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |