C15H12F4IN — CID 107291463
1-[3-fluoro-4-(trifluoromethyl)phenyl]-1-(3-iodophenyl)-N-methylmethanamine (PubChem CID 107291463) has the molecular formula C15H12F4IN and a molecular weight of 409.16 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-1-(3-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-1-(3-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107291463 |
| Molecular Formula | C15H12F4IN |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-1-(3-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(I)c1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C15H12F4IN/c1-21-14(9-3-2-4-11(20)7-9)10-5-6-12(13(16)8-10)15(17,18)19/h2-8,14,21H,1H3 |
| InChIKey | ZVOQMKPRPBYJRB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|