C16H17FIN — CID 65299098
1-(4-fluoro-3,5-dimethylphenyl)-1-(3-iodophenyl)-N-methylmethanamine (PubChem CID 65299098) has the molecular formula C16H17FIN and a molecular weight of 369.22 g/mol. Its IUPAC name is 1-(4-fluoro-3,5-dimethylphenyl)-1-(3-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-fluoro-3,5-dimethylphenyl)-1-(3-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 65299098 |
| Molecular Formula | C16H17FIN |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-(4-fluoro-3,5-dimethylphenyl)-1-(3-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(I)c1)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C16H17FIN/c1-10-7-13(8-11(2)15(10)17)16(19-3)12-5-4-6-14(18)9-12/h4-9,16,19H,1-3H3 |
| InChIKey | UVOFUROVVFWHLQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|