C11H10F4N4 — CID 107289217
1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methyl-1-(2H-triazol-4-yl)methanamine (PubChem CID 107289217) has the molecular formula C11H10F4N4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methyl-1-(2H-triazol-4-yl)methanamine.
| Compound Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methyl-1-(2H-triazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107289217 |
| Molecular Formula | C11H10F4N4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methyl-1-(2H-triazol-4-yl)methanamine |
| SMILES | CNC(c1ccc(C(F)(F)F)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C11H10F4N4/c1-16-10(9-5-17-19-18-9)6-2-3-7(8(12)4-6)11(13,14)15/h2-5,10,16H,1H3,(H,17,18,19) |
| InChIKey | DSBFCWFSHUUSMA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |