C12H13F3N4 — CID 102754821
N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]-1-(2H-triazol-4-yl)methanamine (PubChem CID 102754821) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]-1-(2H-triazol-4-yl)methanamine.
| Compound Name | N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]-1-(2H-triazol-4-yl)methanamine |
|---|---|
| PubChem CID | 102754821 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]-1-(2H-triazol-4-yl)methanamine |
| SMILES | CNC(c1cn[nH]n1)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C12H13F3N4/c1-7-5-8(12(13,14)15)3-4-9(7)11(16-2)10-6-17-19-18-10/h3-6,11,16H,1-2H3,(H,17,18,19) |
| InChIKey | IVKUFZZHPVZGLS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |