C10H12FN5 — CID 107130852
[(3-fluoro-4-methylphenyl)-(2H-triazol-4-yl)methyl]hydrazine (PubChem CID 107130852) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is [(3-fluoro-4-methylphenyl)-(2H-triazol-4-yl)methyl]hydrazine.
| Compound Name | [(3-fluoro-4-methylphenyl)-(2H-triazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107130852 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(3-fluoro-4-methylphenyl)-(2H-triazol-4-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cn[nH]n2)cc1F |
| InChI | InChI=1S/C10H12FN5/c1-6-2-3-7(4-8(6)11)10(14-12)9-5-13-16-15-9/h2-5,10,14H,12H2,1H3,(H,13,15,16) |
| InChIKey | NZTATLIPTKWOPB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|