C11H14N4 — CID 90212492
(1R)-N-methyl-1-(4-methylphenyl)-1-(2H-triazol-4-yl)methanamine (PubChem CID 90212492) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is (1R)-N-methyl-1-(4-methylphenyl)-1-(2H-triazol-4-yl)methanamine.
| Compound Name | (1R)-N-methyl-1-(4-methylphenyl)-1-(2H-triazol-4-yl)methanamine |
|---|---|
| PubChem CID | 90212492 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1R)-N-methyl-1-(4-methylphenyl)-1-(2H-triazol-4-yl)methanamine |
| SMILES | CN[C@H](c1ccc(C)cc1)c1cn[nH]n1 |
| InChI | InChI=1S/C11H14N4/c1-8-3-5-9(6-4-8)11(12-2)10-7-13-15-14-10/h3-7,11-12H,1-2H3,(H,13,14,15)/t11-/m1/s1 |
| InChIKey | PKMWFBMJJKAFKL-LLVKDONJSA-N |
| XLogP | 1.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |