C16H20N2 — CID 116952210
1-[4-(aminomethyl)phenyl]-N-methyl-1-(4-methylphenyl)methanamine (PubChem CID 116952210) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-N-methyl-1-(4-methylphenyl)methanamine.
| Compound Name | 1-[4-(aminomethyl)phenyl]-N-methyl-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 116952210 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-N-methyl-1-(4-methylphenyl)methanamine |
| SMILES | CNC(c1ccc(C)cc1)c1ccc(CN)cc1 |
| InChI | InChI=1S/C16H20N2/c1-12-3-7-14(8-4-12)16(18-2)15-9-5-13(11-17)6-10-15/h3-10,16,18H,11,17H2,1-2H3 |
| InChIKey | LVAAJIIZSIINOI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |