C16H18ClN — CID 107096375
1-(3-chloro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine (PubChem CID 107096375) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 107096375 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine |
| SMILES | CNC(c1ccc(C)cc1)c1cccc(Cl)c1C |
| InChI | InChI=1S/C16H18ClN/c1-11-7-9-13(10-8-11)16(18-3)14-5-4-6-15(17)12(14)2/h4-10,16,18H,1-3H3 |
| InChIKey | ZNAOOPABCDBDTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |