C15H15BrClN — CID 43805217
1-(4-bromo-2-chlorophenyl)-N-methyl-1-(4-methylphenyl)methanamine (PubChem CID 43805217) has the molecular formula C15H15BrClN and a molecular weight of 324.65 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-methyl-1-(4-methylphenyl)methanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-methyl-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 43805217 |
| Molecular Formula | C15H15BrClN |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-methyl-1-(4-methylphenyl)methanamine |
| SMILES | CNC(c1ccc(C)cc1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H15BrClN/c1-10-3-5-11(6-4-10)15(18-2)13-8-7-12(16)9-14(13)17/h3-9,15,18H,1-2H3 |
| InChIKey | RTEVGVFWGIVLPO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |