C14H13BrClN — CID 43805215
1-(4-bromo-2-chlorophenyl)-N-methyl-1-phenylmethanamine (PubChem CID 43805215) has the molecular formula C14H13BrClN and a molecular weight of 310.62 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-methyl-1-phenylmethanamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 43805215 |
| Molecular Formula | C14H13BrClN |
| Molecular Weight | 310.62 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-methyl-1-phenylmethanamine |
| SMILES | CNC(c1ccccc1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H13BrClN/c1-17-14(10-5-3-2-4-6-10)12-8-7-11(15)9-13(12)16/h2-9,14,17H,1H3 |
| InChIKey | WEBMTLKTQRLWTD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |