C16H18BrN — CID 107981867
1-(2-bromo-3-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine (PubChem CID 107981867) has the molecular formula C16H18BrN and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(2-bromo-3-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine.
| Compound Name | 1-(2-bromo-3-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 107981867 |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-(2-bromo-3-methylphenyl)-N-methyl-1-(4-methylphenyl)methanamine |
| SMILES | CNC(c1ccc(C)cc1)c1cccc(C)c1Br |
| InChI | InChI=1S/C16H18BrN/c1-11-7-9-13(10-8-11)16(18-3)14-6-4-5-12(2)15(14)17/h4-10,16,18H,1-3H3 |
| InChIKey | UUUPYSFJIPZBBD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |