C11H12FN5OS — CID 87912837
O-methyl N-[(4-amino-3-fluorophenyl)-(2H-triazol-4-yl)methyl]carbamothioate (PubChem CID 87912837) has the molecular formula C11H12FN5OS and a molecular weight of 281.32 g/mol. Its IUPAC name is O-methyl N-[(4-amino-3-fluorophenyl)-(2H-triazol-4-yl)methyl]carbamothioate.
| Compound Name | O-methyl N-[(4-amino-3-fluorophenyl)-(2H-triazol-4-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 87912837 |
| Molecular Formula | C11H12FN5OS |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | O-methyl N-[(4-amino-3-fluorophenyl)-(2H-triazol-4-yl)methyl]carbamothioate |
| SMILES | COC(=S)NC(c1ccc(N)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C11H12FN5OS/c1-18-11(19)15-10(9-5-14-17-16-9)6-2-3-8(13)7(12)4-6/h2-5,10H,13H2,1H3,(H,15,19)(H,14,16,17) |
| InChIKey | MTKMNOYNNKGZCI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|