C18H21F2N7O3S — CID 90984982
O-methyl N-[[4-[4-(3-amino-3-oxopropanoyl)piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate (PubChem CID 90984982) has the molecular formula C18H21F2N7O3S and a molecular weight of 453.48 g/mol. Its IUPAC name is O-methyl N-[[4-[4-(3-amino-3-oxopropanoyl)piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate.
| Compound Name | O-methyl N-[[4-[4-(3-amino-3-oxopropanoyl)piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 90984982 |
| Molecular Formula | C18H21F2N7O3S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | O-methyl N-[[4-[4-(3-amino-3-oxopropanoyl)piperazin-1-yl]-3,5-difluorophenyl]-(2H-triazol-4-yl)methyl]carbamothioate |
| SMILES | COC(=S)NC(c1cc(F)c(N2CCN(C(=O)CC(N)=O)CC2)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C18H21F2N7O3S/c1-30-18(31)23-16(13-9-22-25-24-13)10-6-11(19)17(12(20)7-10)27-4-2-26(3-5-27)15(29)8-14(21)28/h6-7,9,16H,2-5,8H2,1H3,(H2,21,28)(H,23,31)(H,22,24,25) |
| InChIKey | QAEXOJKJDDPFHX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|