C18H24F2N4O5 — CID 91282647
[3-[4-[4-(2-aminoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-5-yl]methyl methyl carbonate (PubChem CID 91282647) has the molecular formula C18H24F2N4O5 and a molecular weight of 414.41 g/mol. Its IUPAC name is [3-[4-[4-(2-aminoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-5-yl]methyl methyl carbonate.
| Compound Name | [3-[4-[4-(2-aminoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-5-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 91282647 |
| Molecular Formula | C18H24F2N4O5 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [3-[4-[4-(2-aminoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-5-yl]methyl methyl carbonate |
| SMILES | COC(=O)OCC1CN(c2cc(F)c(N3CCN(C(=O)CN)CC3)c(F)c2)CO1 |
| InChI | InChI=1S/C18H24F2N4O5/c1-27-18(26)28-10-13-9-24(11-29-13)12-6-14(19)17(15(20)7-12)23-4-2-22(3-5-23)16(25)8-21/h6-7,13H,2-5,8-11,21H2,1H3 |
| InChIKey | JRTHFMCYKQPFIM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|