C25H27F2N5O6 — CID 91614211
methyl N-[[3-[4-[4-(2-benzamidoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 91614211) has the molecular formula C25H27F2N5O6 and a molecular weight of 531.52 g/mol. Its IUPAC name is methyl N-[[3-[4-[4-(2-benzamidoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | methyl N-[[3-[4-[4-(2-benzamidoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 91614211 |
| Molecular Formula | C25H27F2N5O6 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | methyl N-[[3-[4-[4-(2-benzamidoacetyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | COC(=O)NCC1CN(c2cc(F)c(N3CCN(C(=O)CNC(=O)c4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H27F2N5O6/c1-37-24(35)29-13-18-15-32(25(36)38-18)17-11-19(26)22(20(27)12-17)31-9-7-30(8-10-31)21(33)14-28-23(34)16-5-3-2-4-6-16/h2-6,11-12,18H,7-10,13-15H2,1H3,(H,28,34)(H,29,35) |
| InChIKey | FUWCOKRYYJWIOV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|