C24H31F2N5O6 — CID 143999458
methyl N-[[3-[4-[4-[(Z)-5-aminooxy-5-cyclopropylpent-4-enoyl]piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 143999458) has the molecular formula C24H31F2N5O6 and a molecular weight of 523.54 g/mol. Its IUPAC name is methyl N-[[3-[4-[4-[(Z)-5-aminooxy-5-cyclopropylpent-4-enoyl]piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | methyl N-[[3-[4-[4-[(Z)-5-aminooxy-5-cyclopropylpent-4-enoyl]piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 143999458 |
| Molecular Formula | C24H31F2N5O6 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | methyl N-[[3-[4-[4-[(Z)-5-aminooxy-5-cyclopropylpent-4-enoyl]piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | COC(=O)NCC1CN(c2cc(F)c(N3CCN(C(=O)CC/C=C(\ON)C4CC4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H31F2N5O6/c1-35-23(33)28-13-17-14-31(24(34)36-17)16-11-18(25)22(19(26)12-16)30-9-7-29(8-10-30)21(32)4-2-3-20(37-27)15-5-6-15/h3,11-12,15,17H,2,4-10,13-14,27H2,1H3,(H,28,33)/b20-3- |
| InChIKey | ZNEUHSQHDXAMGZ-DYUKFFQPSA-N |
| XLogP | 2.26 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|